C13H20O3S — CID 79495454
1,1-diethoxy-3-(5-ethylthiophen-2-yl)propan-2-one (PubChem CID 79495454) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1,1-diethoxy-3-(5-ethylthiophen-2-yl)propan-2-one.
| Compound Name | 1,1-diethoxy-3-(5-ethylthiophen-2-yl)propan-2-one |
|---|---|
| PubChem CID | 79495454 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1,1-diethoxy-3-(5-ethylthiophen-2-yl)propan-2-one |
| SMILES | CCOC(OCC)C(=O)Cc1ccc(CC)s1 |
| InChI | InChI=1S/C13H20O3S/c1-4-10-7-8-11(17-10)9-12(14)13(15-5-2)16-6-3/h7-8,13H,4-6,9H2,1-3H3 |
| InChIKey | AGGQMTIHJZXELW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|