C17H28FNO2 — CID 155920505
(1R)-3-amino-1-[4-fluoro-3-(2-propylpentoxy)phenyl]propan-1-ol (PubChem CID 155920505) has the molecular formula C17H28FNO2 and a molecular weight of 297.41 g/mol. Its IUPAC name is (1R)-3-amino-1-[4-fluoro-3-(2-propylpentoxy)phenyl]propan-1-ol.
| Compound Name | (1R)-3-amino-1-[4-fluoro-3-(2-propylpentoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 155920505 |
| Molecular Formula | C17H28FNO2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (1R)-3-amino-1-[4-fluoro-3-(2-propylpentoxy)phenyl]propan-1-ol |
| SMILES | CCCC(CCC)COc1cc([C@H](O)CCN)ccc1F |
| InChI | InChI=1S/C17H28FNO2/c1-3-5-13(6-4-2)12-21-17-11-14(7-8-15(17)18)16(20)9-10-19/h7-8,11,13,16,20H,3-6,9-10,12,19H2,1-2H3/t16-/m1/s1 |
| InChIKey | WDYVEMOTVIKKNU-MRXNPFEDSA-N |
| XLogP | 3.80 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |