C11H10N2O4 — CID 155921153
dimethyl 2-(cyanomethyl)pyridine-3,5-dicarboxylate (PubChem CID 155921153) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is dimethyl 2-(cyanomethyl)pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2-(cyanomethyl)pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 155921153 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | dimethyl 2-(cyanomethyl)pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)c1cnc(CC#N)c(C(=O)OC)c1 |
| InChI | InChI=1S/C11H10N2O4/c1-16-10(14)7-5-8(11(15)17-2)9(3-4-12)13-6-7/h5-6H,3H2,1-2H3 |
| InChIKey | RADQDBPQUYKYDU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 89.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |