C8H9N3O — CID 155921266
2-methyl-5,8-dihydropyrido[4,3-c]pyridazin-3-one (PubChem CID 155921266) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-methyl-5,8-dihydropyrido[4,3-c]pyridazin-3-one.
| Compound Name | 2-methyl-5,8-dihydropyrido[4,3-c]pyridazin-3-one |
|---|---|
| PubChem CID | 155921266 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2-methyl-5,8-dihydropyrido[4,3-c]pyridazin-3-one |
| SMILES | Cn1nc2c(cc1=O)CN=CC2 |
| InChI | InChI=1S/C8H9N3O/c1-11-8(12)4-6-5-9-3-2-7(6)10-11/h3-4H,2,5H2,1H3 |
| InChIKey | PHQPTPIYRVXXHX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |