C28H27F2N5O3S — CID 155921442
7-[3-(2,3-difluorophenyl)phenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 155921442) has the molecular formula C28H27F2N5O3S and a molecular weight of 551.62 g/mol. Its IUPAC name is 7-[3-(2,3-difluorophenyl)phenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | 7-[3-(2,3-difluorophenyl)phenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 155921442 |
| Molecular Formula | C28H27F2N5O3S |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 7-[3-(2,3-difluorophenyl)phenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | C=CC(=O)N1CC[C@@H](NC(=O)C2=C3NC(=O)N(c4cccc(-c5cccc(F)c5F)c4)C4CCNC(S2)C34)C1 |
| InChI | InChI=1S/C28H27F2N5O3S/c1-2-21(36)34-12-10-16(14-34)32-26(37)25-24-22-20(9-11-31-27(22)39-25)35(28(38)33-24)17-6-3-5-15(13-17)18-7-4-8-19(29)23(18)30/h2-8,13,16,20,22,27,31H,1,9-12,14H2,(H,32,37)(H,33,38)/t16-,20?,22?,27?/m1/s1 |
| InChIKey | WCSITOYZDDYBGO-VYSXFQEKSA-N |
| XLogP | 3.33 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|