C23H24ClN5O5S — CID 155922646
7-(5-chloro-1,3-benzodioxol-4-yl)-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 155922646) has the molecular formula C23H24ClN5O5S and a molecular weight of 518.00 g/mol. Its IUPAC name is 7-(5-chloro-1,3-benzodioxol-4-yl)-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | 7-(5-chloro-1,3-benzodioxol-4-yl)-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 155922646 |
| Molecular Formula | C23H24ClN5O5S |
| Molecular Weight | 518.00 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 7-(5-chloro-1,3-benzodioxol-4-yl)-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | C=CC(=O)N1CC[C@@H](NC(=O)C2=C3NC(=O)N(c4c(Cl)ccc5c4OCO5)C4CCNC(S2)C34)C1 |
| InChI | InChI=1S/C23H24ClN5O5S/c1-2-15(30)28-8-6-11(9-28)26-21(31)20-17-16-13(5-7-25-22(16)35-20)29(23(32)27-17)18-12(24)3-4-14-19(18)34-10-33-14/h2-4,11,13,16,22,25H,1,5-10H2,(H,26,31)(H,27,32)/t11-,13?,16?,22?/m1/s1 |
| InChIKey | LBAKHDTYKUQNMG-JJYQMSCCSA-N |
| XLogP | 1.76 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.00 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|