C25H23BrN4O4S — CID 155924571
N-[2-(4-bromophenyl)ethyl]-2-[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]sulfonylacetamide (PubChem CID 155924571) has the molecular formula C25H23BrN4O4S and a molecular weight of 555.45 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)ethyl]-2-[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]sulfonylacetamide.
| Compound Name | N-[2-(4-bromophenyl)ethyl]-2-[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]sulfonylacetamide |
|---|---|
| PubChem CID | 155924571 |
| Molecular Formula | C25H23BrN4O4S |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | N-[2-(4-bromophenyl)ethyl]-2-[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]sulfonylacetamide |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1ccnc(S(=O)(=O)CC(=O)NCCc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C25H23BrN4O4S/c1-17-14-20(4-3-11-27)15-18(2)24(17)34-23-10-13-29-25(30-23)35(32,33)16-22(31)28-12-9-19-5-7-21(26)8-6-19/h3-8,10,13-15H,9,12,16H2,1-2H3,(H,28,31)/b4-3+ |
| InChIKey | JUIYLVCLURIHDO-ONEGZZNKSA-N |
| XLogP | 4.32 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|