C19H19F2NO3S — CID 155927413
3-(3,3-difluoro-1-methoxypropyl)-1-(4-methylphenyl)sulfonylindole (PubChem CID 155927413) has the molecular formula C19H19F2NO3S and a molecular weight of 379.43 g/mol. Its IUPAC name is 3-(3,3-difluoro-1-methoxypropyl)-1-(4-methylphenyl)sulfonylindole.
| Compound Name | 3-(3,3-difluoro-1-methoxypropyl)-1-(4-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 155927413 |
| Molecular Formula | C19H19F2NO3S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-(3,3-difluoro-1-methoxypropyl)-1-(4-methylphenyl)sulfonylindole |
| SMILES | COC(CC(F)F)c1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C19H19F2NO3S/c1-13-7-9-14(10-8-13)26(23,24)22-12-16(18(25-2)11-19(20)21)15-5-3-4-6-17(15)22/h3-10,12,18-19H,11H2,1-2H3 |
| InChIKey | QVDFLAYHUZQLLQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |