C26H44O4Si — CID 155929229
(3R,3aS,4S,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-4-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one (PubChem CID 155929229) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is (3R,3aS,4S,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-4-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one.
| Compound Name | (3R,3aS,4S,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-4-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
|---|---|
| PubChem CID | 155929229 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (3R,3aS,4S,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-4-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
| SMILES | C=C([C@H]1CC[C@H]2C(C)(C)CCC[C@]12C)[C@@H]1CO[C@@H]2OC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]21 |
| InChI | InChI=1S/C26H44O4Si/c1-16(18-11-12-19-25(5,6)13-10-14-26(18,19)7)17-15-28-23-20(17)21(22(27)29-23)30-31(8,9)24(2,3)4/h17-21,23H,1,10-15H2,2-9H3/t17-,18+,19-,20-,21-,23+,26+/m0/s1 |
| InChIKey | RGCZCFAAUHWAME-HAGROPKBSA-N |
| XLogP | 6.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|