C13H16N3OS+ — CID 155929442
2-piperidin-1-ium-3-yl-4-thiophen-2-yl-1H-pyrimidin-6-one (PubChem CID 155929442) has the molecular formula C13H16N3OS+ and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-piperidin-1-ium-3-yl-4-thiophen-2-yl-1H-pyrimidin-6-one.
| Compound Name | 2-piperidin-1-ium-3-yl-4-thiophen-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 155929442 |
| Molecular Formula | C13H16N3OS+ |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-piperidin-1-ium-3-yl-4-thiophen-2-yl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2cccs2)nc(C2CCC[NH2+]C2)[nH]1 |
| InChI | InChI=1S/C13H15N3OS/c17-12-7-10(11-4-2-6-18-11)15-13(16-12)9-3-1-5-14-8-9/h2,4,6-7,9,14H,1,3,5,8H2,(H,15,16,17)/p+1 |
| InChIKey | SYPJDYINOUZFIH-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |