C12H17NOS2 — CID 155929941
(NE,S)-2-methyl-N-(2-phenylsulfanylethylidene)propane-2-sulfinamide (PubChem CID 155929941) has the molecular formula C12H17NOS2 and a molecular weight of 255.41 g/mol. Its IUPAC name is (NE,S)-2-methyl-N-(2-phenylsulfanylethylidene)propane-2-sulfinamide.
| Compound Name | (NE,S)-2-methyl-N-(2-phenylsulfanylethylidene)propane-2-sulfinamide |
|---|---|
| PubChem CID | 155929941 |
| Molecular Formula | C12H17NOS2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (NE,S)-2-methyl-N-(2-phenylsulfanylethylidene)propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)/N=C/CSc1ccccc1 |
| InChI | InChI=1S/C12H17NOS2/c1-12(2,3)16(14)13-9-10-15-11-7-5-4-6-8-11/h4-9H,10H2,1-3H3/b13-9+/t16-/m0/s1 |
| InChIKey | XBYRYSOUUOANNN-WQMJKPAKSA-N |
| XLogP | 3.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|