C12H19NOS — CID 12033918
2,2-dimethylpropylimino-methyl-oxo-phenyl-λ6-sulfane (PubChem CID 12033918) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 2,2-dimethylpropylimino-methyl-oxo-phenyl-λ6-sulfane.
| Compound Name | 2,2-dimethylpropylimino-methyl-oxo-phenyl-λ6-sulfane |
|---|---|
| PubChem CID | 12033918 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2,2-dimethylpropylimino-methyl-oxo-phenyl-λ6-sulfane |
| SMILES | CC(C)(C)CN=S(C)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H19NOS/c1-12(2,3)10-13-15(4,14)11-8-6-5-7-9-11/h5-9H,10H2,1-4H3 |
| InChIKey | PKMDGRJYOOBLJN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |