C19H28O5 — CID 155930906
(2R,3S)-2-(2-methoxy-6-pentylbenzoyl)oxy-3-methylpentanoic acid (PubChem CID 155930906) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (2R,3S)-2-(2-methoxy-6-pentylbenzoyl)oxy-3-methylpentanoic acid.
| Compound Name | (2R,3S)-2-(2-methoxy-6-pentylbenzoyl)oxy-3-methylpentanoic acid |
|---|---|
| PubChem CID | 155930906 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (2R,3S)-2-(2-methoxy-6-pentylbenzoyl)oxy-3-methylpentanoic acid |
| SMILES | CCCCCc1cccc(OC)c1C(=O)O[C@@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C19H28O5/c1-5-7-8-10-14-11-9-12-15(23-4)16(14)19(22)24-17(18(20)21)13(3)6-2/h9,11-13,17H,5-8,10H2,1-4H3,(H,20,21)/t13-,17+/m0/s1 |
| InChIKey | APZHHXVAVYGQDO-SUMWQHHRSA-N |
| XLogP | 4.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|