C21H18F3NO3 — CID 155931040
methyl (4S)-4-[(1S)-1-phenylprop-2-enyl]-2-[4-(trifluoromethyl)phenyl]-5H-1,3-oxazole-4-carboxylate (PubChem CID 155931040) has the molecular formula C21H18F3NO3 and a molecular weight of 389.37 g/mol. Its IUPAC name is methyl (4S)-4-[(1S)-1-phenylprop-2-enyl]-2-[4-(trifluoromethyl)phenyl]-5H-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4S)-4-[(1S)-1-phenylprop-2-enyl]-2-[4-(trifluoromethyl)phenyl]-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 155931040 |
| Molecular Formula | C21H18F3NO3 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | methyl (4S)-4-[(1S)-1-phenylprop-2-enyl]-2-[4-(trifluoromethyl)phenyl]-5H-1,3-oxazole-4-carboxylate |
| SMILES | C=C[C@@H](c1ccccc1)[C@@]1(C(=O)OC)COC(c2ccc(C(F)(F)F)cc2)=N1 |
| InChI | InChI=1S/C21H18F3NO3/c1-3-17(14-7-5-4-6-8-14)20(19(26)27-2)13-28-18(25-20)15-9-11-16(12-10-15)21(22,23)24/h3-12,17H,1,13H2,2H3/t17-,20+/m0/s1 |
| InChIKey | GTCZHPIVINVRNK-FXAWDEMLSA-N |
| XLogP | 4.36 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|