About ethyl acetate;iodocopper(1+)
ethyl acetate;iodocopper(1+) (PubChem CID 155931181) has the molecular formula C4H7CuIO2
and a molecular weight of 277.55 g/mol. Its IUPAC name is ethyl acetate;iodocopper(1+).
Molecular Properties
| Compound Name | ethyl acetate;iodocopper(1+) |
| PubChem CID | 155931181 |
| Molecular Formula | C4H7CuIO2 |
| Molecular Weight | 277.55 g/mol |
| Exact Mass | 276.88 |
| IUPAC Name | ethyl acetate;iodocopper(1+) |
| SMILES | [CH2-]C(=O)OCC.[Cu+]I |
| InChI | InChI=1S/C4H7O2.Cu.HI/c1-3-6-4(2)5;;/h2-3H2,1H3;;1H/q-1;+2;/p-1 |
| InChIKey | BRPIMSKDTDSMBC-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.55 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl acetate;iodocopper(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;iodocopper(1+)?
The IUPAC name of ethyl acetate;iodocopper(1+) (CID 155931181) is ethyl acetate;iodocopper(1+).
What is the SMILES notation for ethyl acetate;iodocopper(1+)?
The canonical SMILES for ethyl acetate;iodocopper(1+) is [CH2-]C(=O)OCC.[Cu+]I.
What is the InChIKey of ethyl acetate;iodocopper(1+)?
The InChIKey is BRPIMSKDTDSMBC-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H7O2.Cu.HI/c1-3-6-4(2)5;;/h2-3H2,1H3;;1H/q-1;+2;/p-1.
What are the key properties of ethyl acetate;iodocopper(1+)?
ethyl acetate;iodocopper(1+) has a molecular weight of 277.55 g/mol, XLogP of 1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;iodocopper(1+) is sourced from PubChem (CID 155931181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).