About ethyl acetate;methylbenzene;yttrium
ethyl acetate;methylbenzene;yttrium (PubChem CID 58712975) has the molecular formula C11H14O2Y-2
and a molecular weight of 267.14 g/mol. Its IUPAC name is ethyl acetate;methylbenzene;yttrium.
Molecular Properties
| Compound Name | ethyl acetate;methylbenzene;yttrium |
| PubChem CID | 58712975 |
| Molecular Formula | C11H14O2Y-2 |
| Molecular Weight | 267.14 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | ethyl acetate;methylbenzene;yttrium |
| SMILES | Cc1cc[c-]cc1.[CH2-]C(=O)OCC.[Y] |
| InChI | InChI=1S/C7H7.C4H7O2.Y/c1-7-5-3-2-4-6-7;1-3-6-4(2)5;/h3-6H,1H3;2-3H2,1H3;/q2*-1; |
| InChIKey | CZMXRJSDSJFSQM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.14 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethyl acetate;methylbenzene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;methylbenzene;yttrium?
The IUPAC name of ethyl acetate;methylbenzene;yttrium (CID 58712975) is ethyl acetate;methylbenzene;yttrium.
What is the SMILES notation for ethyl acetate;methylbenzene;yttrium?
The canonical SMILES for ethyl acetate;methylbenzene;yttrium is Cc1cc[c-]cc1.[CH2-]C(=O)OCC.[Y].
What is the InChIKey of ethyl acetate;methylbenzene;yttrium?
The InChIKey is CZMXRJSDSJFSQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.C4H7O2.Y/c1-7-5-3-2-4-6-7;1-3-6-4(2)5;/h3-6H,1H3;2-3H2,1H3;/q2*-1;.
What are the key properties of ethyl acetate;methylbenzene;yttrium?
ethyl acetate;methylbenzene;yttrium has a molecular weight of 267.14 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;methylbenzene;yttrium is sourced from PubChem (CID 58712975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).