About carbanide;dioxouranium(2+);methylbenzene
carbanide;dioxouranium(2+);methylbenzene (PubChem CID 163813971) has the molecular formula C8H10O2U
and a molecular weight of 376.20 g/mol. Its IUPAC name is carbanide;dioxouranium(2+);methylbenzene.
Molecular Properties
| Compound Name | carbanide;dioxouranium(2+);methylbenzene |
| PubChem CID | 163813971 |
| Molecular Formula | C8H10O2U |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | carbanide;dioxouranium(2+);methylbenzene |
| SMILES | Cc1cc[c-]cc1.O=[U+2]=O.[CH3-] |
| InChI | InChI=1S/C7H7.CH3.2O.U/c1-7-5-3-2-4-6-7;;;;/h3-6H,1H3;1H3;;;/q2*-1;;;+2 |
| InChIKey | LNIXNBUEUYYVNV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;dioxouranium(2+);methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;dioxouranium(2+);methylbenzene?
The IUPAC name of carbanide;dioxouranium(2+);methylbenzene (CID 163813971) is carbanide;dioxouranium(2+);methylbenzene.
What is the SMILES notation for carbanide;dioxouranium(2+);methylbenzene?
The canonical SMILES for carbanide;dioxouranium(2+);methylbenzene is Cc1cc[c-]cc1.O=[U+2]=O.[CH3-].
What is the InChIKey of carbanide;dioxouranium(2+);methylbenzene?
The InChIKey is LNIXNBUEUYYVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.CH3.2O.U/c1-7-5-3-2-4-6-7;;;;/h3-6H,1H3;1H3;;;/q2*-1;;;+2.
What are the key properties of carbanide;dioxouranium(2+);methylbenzene?
carbanide;dioxouranium(2+);methylbenzene has a molecular weight of 376.20 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;dioxouranium(2+);methylbenzene is sourced from PubChem (CID 163813971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).