About acetic acid;methylbenzene;tungsten(2+)
acetic acid;methylbenzene;tungsten(2+) (PubChem CID 140735464) has the molecular formula C9H10O2W
and a molecular weight of 334.02 g/mol. Its IUPAC name is acetic acid;methylbenzene;tungsten(2+).
Molecular Properties
| Compound Name | acetic acid;methylbenzene;tungsten(2+) |
| PubChem CID | 140735464 |
| Molecular Formula | C9H10O2W |
| Molecular Weight | 334.02 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | acetic acid;methylbenzene;tungsten(2+) |
| SMILES | Cc1cc[c-]cc1.[CH2-]C(=O)O.[W+2] |
| InChI | InChI=1S/C7H7.C2H3O2.W/c1-7-5-3-2-4-6-7;1-2(3)4;/h3-6H,1H3;1H2,(H,3,4);/q2*-1;+2 |
| InChIKey | AWTZGDDHZLRVHI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.02 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;methylbenzene;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;methylbenzene;tungsten(2+)?
The IUPAC name of acetic acid;methylbenzene;tungsten(2+) (CID 140735464) is acetic acid;methylbenzene;tungsten(2+).
What is the SMILES notation for acetic acid;methylbenzene;tungsten(2+)?
The canonical SMILES for acetic acid;methylbenzene;tungsten(2+) is Cc1cc[c-]cc1.[CH2-]C(=O)O.[W+2].
What is the InChIKey of acetic acid;methylbenzene;tungsten(2+)?
The InChIKey is AWTZGDDHZLRVHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.C2H3O2.W/c1-7-5-3-2-4-6-7;1-2(3)4;/h3-6H,1H3;1H2,(H,3,4);/q2*-1;+2.
What are the key properties of acetic acid;methylbenzene;tungsten(2+)?
acetic acid;methylbenzene;tungsten(2+) has a molecular weight of 334.02 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;methylbenzene;tungsten(2+) is sourced from PubChem (CID 140735464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).