C11H24O3Si — CID 155931801
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoic acid (PubChem CID 155931801) has the molecular formula C11H24O3Si and a molecular weight of 232.40 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoic acid.
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoic acid |
|---|---|
| PubChem CID | 155931801 |
| Molecular Formula | C11H24O3Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoic acid |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C11H24O3Si/c1-8(10(12)13)9(2)14-15(6,7)11(3,4)5/h8-9H,1-7H3,(H,12,13)/t8-,9+/m1/s1 |
| InChIKey | WGOGVVAQGYTWHU-BDAKNGLRSA-N |
| XLogP | 3.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|