C17H23BrO — CID 155932036
3-(2-bromophenyl)-1-cyclohexyl-2,2-dimethylpropan-1-one (PubChem CID 155932036) has the molecular formula C17H23BrO and a molecular weight of 323.27 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1-cyclohexyl-2,2-dimethylpropan-1-one.
| Compound Name | 3-(2-bromophenyl)-1-cyclohexyl-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 155932036 |
| Molecular Formula | C17H23BrO |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 3-(2-bromophenyl)-1-cyclohexyl-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(Cc1ccccc1Br)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C17H23BrO/c1-17(2,12-14-10-6-7-11-15(14)18)16(19)13-8-4-3-5-9-13/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3 |
| InChIKey | RYNKAVAQSPNROO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |