C18H14O2 — CID 155932046
(3aR,8bR)-8b-hydroxy-3a-phenyl-3H-cyclopenta[b]inden-4-one (PubChem CID 155932046) has the molecular formula C18H14O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is (3aR,8bR)-8b-hydroxy-3a-phenyl-3H-cyclopenta[b]inden-4-one.
| Compound Name | (3aR,8bR)-8b-hydroxy-3a-phenyl-3H-cyclopenta[b]inden-4-one |
|---|---|
| PubChem CID | 155932046 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (3aR,8bR)-8b-hydroxy-3a-phenyl-3H-cyclopenta[b]inden-4-one |
| SMILES | O=C1c2ccccc2[C@]2(O)C=CC[C@]12c1ccccc1 |
| InChI | InChI=1S/C18H14O2/c19-16-14-9-4-5-10-15(14)18(20)12-6-11-17(16,18)13-7-2-1-3-8-13/h1-10,12,20H,11H2/t17-,18+/m0/s1 |
| InChIKey | FHIJMGFGYNVHRC-ZWKOTPCHSA-N |
| XLogP | 2.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|