C16H10N2OS — CID 155932106
pyrrolo[1,2-a]quinoxalin-4-yl(thiophen-2-yl)methanone (PubChem CID 155932106) has the molecular formula C16H10N2OS and a molecular weight of 278.34 g/mol. Its IUPAC name is pyrrolo[1,2-a]quinoxalin-4-yl(thiophen-2-yl)methanone.
| Compound Name | pyrrolo[1,2-a]quinoxalin-4-yl(thiophen-2-yl)methanone |
|---|---|
| PubChem CID | 155932106 |
| Molecular Formula | C16H10N2OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | pyrrolo[1,2-a]quinoxalin-4-yl(thiophen-2-yl)methanone |
| SMILES | O=C(c1cccs1)c1nc2ccccc2n2cccc12 |
| InChI | InChI=1S/C16H10N2OS/c19-16(14-8-4-10-20-14)15-13-7-3-9-18(13)12-6-2-1-5-11(12)17-15/h1-10H |
| InChIKey | DJICQYDJCPCIPK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |