C16H10N2OS — CID 102428591
9H-pyrido[3,4-b]indol-1-yl(thiophen-2-yl)methanone (PubChem CID 102428591) has the molecular formula C16H10N2OS and a molecular weight of 278.34 g/mol. Its IUPAC name is 9H-pyrido[3,4-b]indol-1-yl(thiophen-2-yl)methanone.
| Compound Name | 9H-pyrido[3,4-b]indol-1-yl(thiophen-2-yl)methanone |
|---|---|
| PubChem CID | 102428591 |
| Molecular Formula | C16H10N2OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 9H-pyrido[3,4-b]indol-1-yl(thiophen-2-yl)methanone |
| SMILES | O=C(c1cccs1)c1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C16H10N2OS/c19-16(13-6-3-9-20-13)15-14-11(7-8-17-15)10-4-1-2-5-12(10)18-14/h1-9,18H |
| InChIKey | NFMVFANBBVHDEL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |