C26H33F3O2Si — CID 155932824
(1S,2R,3Z,5E)-7-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-2-[4-(trifluoromethyl)phenyl]hepta-3,5-dien-1-ol (PubChem CID 155932824) has the molecular formula C26H33F3O2Si and a molecular weight of 462.63 g/mol. Its IUPAC name is (1S,2R,3Z,5E)-7-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-2-[4-(trifluoromethyl)phenyl]hepta-3,5-dien-1-ol.
| Compound Name | (1S,2R,3Z,5E)-7-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-2-[4-(trifluoromethyl)phenyl]hepta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 155932824 |
| Molecular Formula | C26H33F3O2Si |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (1S,2R,3Z,5E)-7-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-2-[4-(trifluoromethyl)phenyl]hepta-3,5-dien-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/C=C\[C@H](c1ccc(C(F)(F)F)cc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C26H33F3O2Si/c1-25(2,3)32(4,5)31-19-11-7-10-14-23(24(30)21-12-8-6-9-13-21)20-15-17-22(18-16-20)26(27,28)29/h6-18,23-24,30H,19H2,1-5H3/b11-7+,14-10-/t23-,24-/m1/s1 |
| InChIKey | HPBNHOCOQBSPND-YOMBIHHHSA-N |
| XLogP | 7.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|