C22H22N2O3 — CID 155932973
3-benzyl-2-(4-methoxybenzoyl)-1,3-diazaspiro[4.4]non-1-en-4-one (PubChem CID 155932973) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-benzyl-2-(4-methoxybenzoyl)-1,3-diazaspiro[4.4]non-1-en-4-one.
| Compound Name | 3-benzyl-2-(4-methoxybenzoyl)-1,3-diazaspiro[4.4]non-1-en-4-one |
|---|---|
| PubChem CID | 155932973 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-benzyl-2-(4-methoxybenzoyl)-1,3-diazaspiro[4.4]non-1-en-4-one |
| SMILES | COc1ccc(C(=O)C2=NC3(CCCC3)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2O3/c1-27-18-11-9-17(10-12-18)19(25)20-23-22(13-5-6-14-22)21(26)24(20)15-16-7-3-2-4-8-16/h2-4,7-12H,5-6,13-15H2,1H3 |
| InChIKey | KITSZWZEPRCQEW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |