C24H29NO3 — CID 10872588
(3S)-3-benzyl-4-[(4-methoxyphenyl)methyl]-1-oxa-4-azaspiro[5.5]undecan-5-one (PubChem CID 10872588) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is (3S)-3-benzyl-4-[(4-methoxyphenyl)methyl]-1-oxa-4-azaspiro[5.5]undecan-5-one.
| Compound Name | (3S)-3-benzyl-4-[(4-methoxyphenyl)methyl]-1-oxa-4-azaspiro[5.5]undecan-5-one |
|---|---|
| PubChem CID | 10872588 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (3S)-3-benzyl-4-[(4-methoxyphenyl)methyl]-1-oxa-4-azaspiro[5.5]undecan-5-one |
| SMILES | COc1ccc(CN2C(=O)C3(CCCCC3)OC[C@@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H29NO3/c1-27-22-12-10-20(11-13-22)17-25-21(16-19-8-4-2-5-9-19)18-28-24(23(25)26)14-6-3-7-15-24/h2,4-5,8-13,21H,3,6-7,14-18H2,1H3/t21-/m0/s1 |
| InChIKey | WIVBGTQWFTXSJS-NRFANRHFSA-N |
| XLogP | 4.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |