C12H21N3OS — CID 15593384
1-cyclohexyl-3-(3,3-dimethyl-2-oxoazetidin-1-yl)thiourea (PubChem CID 15593384) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,3-dimethyl-2-oxoazetidin-1-yl)thiourea.
| Compound Name | 1-cyclohexyl-3-(3,3-dimethyl-2-oxoazetidin-1-yl)thiourea |
|---|---|
| PubChem CID | 15593384 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1-cyclohexyl-3-(3,3-dimethyl-2-oxoazetidin-1-yl)thiourea |
| SMILES | CC1(C)CN(NC(=S)NC2CCCCC2)C1=O |
| InChI | InChI=1S/C12H21N3OS/c1-12(2)8-15(10(12)16)14-11(17)13-9-6-4-3-5-7-9/h9H,3-8H2,1-2H3,(H2,13,14,17) |
| InChIKey | PBENARBDQBSZAE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|