C24H27F3N2O4 — CID 155933879
2-benzamido-2-[4-(diethylcarbamoyl)-2-(4,4,4-trifluorobutyl)phenyl]acetic acid (PubChem CID 155933879) has the molecular formula C24H27F3N2O4 and a molecular weight of 464.48 g/mol. Its IUPAC name is 2-benzamido-2-[4-(diethylcarbamoyl)-2-(4,4,4-trifluorobutyl)phenyl]acetic acid.
| Compound Name | 2-benzamido-2-[4-(diethylcarbamoyl)-2-(4,4,4-trifluorobutyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 155933879 |
| Molecular Formula | C24H27F3N2O4 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2-benzamido-2-[4-(diethylcarbamoyl)-2-(4,4,4-trifluorobutyl)phenyl]acetic acid |
| SMILES | CCN(CC)C(=O)c1ccc(C(NC(=O)c2ccccc2)C(=O)O)c(CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C24H27F3N2O4/c1-3-29(4-2)22(31)18-12-13-19(17(15-18)11-8-14-24(25,26)27)20(23(32)33)28-21(30)16-9-6-5-7-10-16/h5-7,9-10,12-13,15,20H,3-4,8,11,14H2,1-2H3,(H,28,30)(H,32,33) |
| InChIKey | FHBGXIMBWHMZQX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |