C23H42O2Si — CID 155935116
(3aR,5aR,7S,9aS,9bR)-7-[tert-butyl(dimethyl)silyl]oxy-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one (PubChem CID 155935116) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is (3aR,5aR,7S,9aS,9bR)-7-[tert-butyl(dimethyl)silyl]oxy-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one.
| Compound Name | (3aR,5aR,7S,9aS,9bR)-7-[tert-butyl(dimethyl)silyl]oxy-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one |
|---|---|
| PubChem CID | 155935116 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | (3aR,5aR,7S,9aS,9bR)-7-[tert-butyl(dimethyl)silyl]oxy-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one |
| SMILES | CC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@H]3CCC(=O)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C23H42O2Si/c1-20(2,3)26(8,9)25-19-13-15-22(6)16(21(19,4)5)12-14-23(7)17(22)10-11-18(23)24/h16-17,19H,10-15H2,1-9H3/t16-,17+,19-,22-,23+/m0/s1 |
| InChIKey | XSBADFLLANGZBS-IGGQLTPSSA-N |
| XLogP | 6.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|