C16H13FO2 — CID 155935678
(3S)-3-fluoro-5,5-diphenyloxolan-2-one (PubChem CID 155935678) has the molecular formula C16H13FO2 and a molecular weight of 256.28 g/mol. Its IUPAC name is (3S)-3-fluoro-5,5-diphenyloxolan-2-one.
| Compound Name | (3S)-3-fluoro-5,5-diphenyloxolan-2-one |
|---|---|
| PubChem CID | 155935678 |
| Molecular Formula | C16H13FO2 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (3S)-3-fluoro-5,5-diphenyloxolan-2-one |
| SMILES | O=C1OC(c2ccccc2)(c2ccccc2)C[C@@H]1F |
| InChI | InChI=1S/C16H13FO2/c17-14-11-16(19-15(14)18,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H,11H2/t14-/m0/s1 |
| InChIKey | PXJHTQXKBLMATI-AWEZNQCLSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |