C21H35NO2 — CID 155935852
tert-butyl 4-(4,8-dimethylnona-3,7-dienyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 155935852) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is tert-butyl 4-(4,8-dimethylnona-3,7-dienyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-(4,8-dimethylnona-3,7-dienyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 155935852 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | tert-butyl 4-(4,8-dimethylnona-3,7-dienyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)=CCCC(C)=CCCC1=CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H35NO2/c1-17(2)9-7-10-18(3)11-8-12-19-13-15-22(16-14-19)20(23)24-21(4,5)6/h9,11,13H,7-8,10,12,14-16H2,1-6H3 |
| InChIKey | COJPYSJMDZHYIC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|