C24H35N2O3P — CID 155935855
[2-bis(tert-butylamino)phosphanyloxy-1,2-diphenylethyl] acetate (PubChem CID 155935855) has the molecular formula C24H35N2O3P and a molecular weight of 430.53 g/mol. Its IUPAC name is [2-bis(tert-butylamino)phosphanyloxy-1,2-diphenylethyl] acetate.
| Compound Name | [2-bis(tert-butylamino)phosphanyloxy-1,2-diphenylethyl] acetate |
|---|---|
| PubChem CID | 155935855 |
| Molecular Formula | C24H35N2O3P |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [2-bis(tert-butylamino)phosphanyloxy-1,2-diphenylethyl] acetate |
| SMILES | CC(=O)OC(c1ccccc1)C(OP(NC(C)(C)C)NC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H35N2O3P/c1-18(27)28-21(19-14-10-8-11-15-19)22(20-16-12-9-13-17-20)29-30(25-23(2,3)4)26-24(5,6)7/h8-17,21-22,25-26H,1-7H3 |
| InChIKey | SGJHSNDXNSTZPR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|