C16H26NO2+ — CID 7586320
[(1S,2S)-1-acetyloxy-1-phenylpropan-2-yl]-dimethyl-propylazanium (PubChem CID 7586320) has the molecular formula C16H26NO2+ and a molecular weight of 264.39 g/mol. Its IUPAC name is [(1S,2S)-1-acetyloxy-1-phenylpropan-2-yl]-dimethyl-propylazanium.
| Compound Name | [(1S,2S)-1-acetyloxy-1-phenylpropan-2-yl]-dimethyl-propylazanium |
|---|---|
| PubChem CID | 7586320 |
| Molecular Formula | C16H26NO2+ |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | [(1S,2S)-1-acetyloxy-1-phenylpropan-2-yl]-dimethyl-propylazanium |
| SMILES | CCC[N+](C)(C)[C@@H](C)[C@@H](OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C16H26NO2/c1-6-12-17(4,5)13(2)16(19-14(3)18)15-10-8-7-9-11-15/h7-11,13,16H,6,12H2,1-5H3/q+1/t13-,16+/m0/s1 |
| InChIKey | DEAFFDUUUHQLEP-XJKSGUPXSA-N |
| XLogP | 3.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|