C24H18F3NO4 — CID 155937581
4-[1-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2,2-trifluoroethyl]benzoic acid (PubChem CID 155937581) has the molecular formula C24H18F3NO4 and a molecular weight of 441.41 g/mol. Its IUPAC name is 4-[1-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2,2-trifluoroethyl]benzoic acid.
| Compound Name | 4-[1-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2,2-trifluoroethyl]benzoic acid |
|---|---|
| PubChem CID | 155937581 |
| Molecular Formula | C24H18F3NO4 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 4-[1-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2,2-trifluoroethyl]benzoic acid |
| SMILES | O=C(NC(c1ccc(C(=O)O)cc1)C(F)(F)F)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H18F3NO4/c25-24(26,27)21(14-9-11-15(12-10-14)22(29)30)28-23(31)32-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20-21H,13H2,(H,28,31)(H,29,30) |
| InChIKey | DMVNJACDYBVUIY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |