C24H32N4O8 — CID 155938192
formic acid;(1S,8R)-9-[[2-(3-imidazol-1-ylpropoxy)-3-methoxyphenyl]methyl]-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one (PubChem CID 155938192) has the molecular formula C24H32N4O8 and a molecular weight of 504.54 g/mol. Its IUPAC name is formic acid;(1S,8R)-9-[[2-(3-imidazol-1-ylpropoxy)-3-methoxyphenyl]methyl]-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one.
| Compound Name | formic acid;(1S,8R)-9-[[2-(3-imidazol-1-ylpropoxy)-3-methoxyphenyl]methyl]-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
|---|---|
| PubChem CID | 155938192 |
| Molecular Formula | C24H32N4O8 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | formic acid;(1S,8R)-9-[[2-(3-imidazol-1-ylpropoxy)-3-methoxyphenyl]methyl]-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
| SMILES | COc1cccc(CN2CC[C@@]34OCCN3C(=O)C[C@@H]24)c1OCCCn1ccnc1.O=CO.O=CO |
| InChI | InChI=1S/C22H28N4O4.2CH2O2/c1-28-18-5-2-4-17(21(18)29-12-3-8-24-10-7-23-16-24)15-25-9-6-22-19(25)14-20(27)26(22)11-13-30-22;2*2-1-3/h2,4-5,7,10,16,19H,3,6,8-9,11-15H2,1H3;2*1H,(H,2,3)/t19-,22+;;/m1../s1 |
| InChIKey | DWJUKWQKFPVEDE-GOOHIXEASA-N |
| XLogP | 1.30 |
| TPSA | 143.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|