C24H33N3O3 — CID 135114118
9-[[2-(3-imidazol-1-ylpropoxy)-3-methoxyphenyl]methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undec-4-ene (PubChem CID 135114118) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 9-[[2-(3-imidazol-1-ylpropoxy)-3-methoxyphenyl]methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undec-4-ene.
| Compound Name | 9-[[2-(3-imidazol-1-ylpropoxy)-3-methoxyphenyl]methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undec-4-ene |
|---|---|
| PubChem CID | 135114118 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 9-[[2-(3-imidazol-1-ylpropoxy)-3-methoxyphenyl]methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undec-4-ene |
| SMILES | COc1cccc(CN2CCC3(C=C(C)CCO3)CC2)c1OCCCn1ccnc1 |
| InChI | InChI=1S/C24H33N3O3/c1-20-7-16-30-24(17-20)8-12-26(13-9-24)18-21-5-3-6-22(28-2)23(21)29-15-4-11-27-14-10-25-19-27/h3,5-6,10,14,17,19H,4,7-9,11-13,15-16,18H2,1-2H3 |
| InChIKey | VGMMJIPTRCYCHL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|