C20H24N4O4 — CID 155938206
1,2-dimethyl-4-[1-[4-(oxolan-2-ylmethoxy)phenyl]imidazol-2-yl]imidazole;formic acid (PubChem CID 155938206) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1,2-dimethyl-4-[1-[4-(oxolan-2-ylmethoxy)phenyl]imidazol-2-yl]imidazole;formic acid.
| Compound Name | 1,2-dimethyl-4-[1-[4-(oxolan-2-ylmethoxy)phenyl]imidazol-2-yl]imidazole;formic acid |
|---|---|
| PubChem CID | 155938206 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1,2-dimethyl-4-[1-[4-(oxolan-2-ylmethoxy)phenyl]imidazol-2-yl]imidazole;formic acid |
| SMILES | Cc1nc(-c2nccn2-c2ccc(OCC3CCCO3)cc2)cn1C.O=CO |
| InChI | InChI=1S/C19H22N4O2.CH2O2/c1-14-21-18(12-22(14)2)19-20-9-10-23(19)15-5-7-16(8-6-15)25-13-17-4-3-11-24-17;2-1-3/h5-10,12,17H,3-4,11,13H2,1-2H3;1H,(H,2,3) |
| InChIKey | GPDGBFWKKGIEEN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|