C13H15N3O2 — CID 95127690
4-[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]-1,2,4-triazole (PubChem CID 95127690) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]-1,2,4-triazole.
| Compound Name | 4-[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 95127690 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]-1,2,4-triazole |
| SMILES | c1cc(-n2cnnc2)ccc1OC[C@H]1CCCO1 |
| InChI | InChI=1S/C13H15N3O2/c1-2-13(17-7-1)8-18-12-5-3-11(4-6-12)16-9-14-15-10-16/h3-6,9-10,13H,1-2,7-8H2/t13-/m1/s1 |
| InChIKey | PHCVPWDBJGYKRS-CYBMUJFWSA-N |
| XLogP | 1.83 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |