C19H25N7O3 — CID 155939309
5-[1-[(1-ethylimidazol-4-yl)methyl]imidazol-2-yl]-N-(oxolan-2-ylmethyl)pyrimidin-2-amine;formic acid (PubChem CID 155939309) has the molecular formula C19H25N7O3 and a molecular weight of 399.46 g/mol. Its IUPAC name is 5-[1-[(1-ethylimidazol-4-yl)methyl]imidazol-2-yl]-N-(oxolan-2-ylmethyl)pyrimidin-2-amine;formic acid.
| Compound Name | 5-[1-[(1-ethylimidazol-4-yl)methyl]imidazol-2-yl]-N-(oxolan-2-ylmethyl)pyrimidin-2-amine;formic acid |
|---|---|
| PubChem CID | 155939309 |
| Molecular Formula | C19H25N7O3 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 5-[1-[(1-ethylimidazol-4-yl)methyl]imidazol-2-yl]-N-(oxolan-2-ylmethyl)pyrimidin-2-amine;formic acid |
| SMILES | CCn1cnc(Cn2ccnc2-c2cnc(NCC3CCCO3)nc2)c1.O=CO |
| InChI | InChI=1S/C18H23N7O.CH2O2/c1-2-24-11-15(23-13-24)12-25-6-5-19-17(25)14-8-20-18(21-9-14)22-10-16-4-3-7-26-16;2-1-3/h5-6,8-9,11,13,16H,2-4,7,10,12H2,1H3,(H,20,21,22);1H,(H,2,3) |
| InChIKey | ATFZQYMQBASWEN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|