C16H25NO5 — CID 155940077
2-ethoxy-4-[[[(1S,3R)-3-hydroxycyclohexyl]amino]methyl]phenol;formic acid (PubChem CID 155940077) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-ethoxy-4-[[[(1S,3R)-3-hydroxycyclohexyl]amino]methyl]phenol;formic acid.
| Compound Name | 2-ethoxy-4-[[[(1S,3R)-3-hydroxycyclohexyl]amino]methyl]phenol;formic acid |
|---|---|
| PubChem CID | 155940077 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-ethoxy-4-[[[(1S,3R)-3-hydroxycyclohexyl]amino]methyl]phenol;formic acid |
| SMILES | CCOc1cc(CN[C@H]2CCC[C@@H](O)C2)ccc1O.O=CO |
| InChI | InChI=1S/C15H23NO3.CH2O2/c1-2-19-15-8-11(6-7-14(15)18)10-16-12-4-3-5-13(17)9-12;2-1-3/h6-8,12-13,16-18H,2-5,9-10H2,1H3;1H,(H,2,3)/t12-,13+;/m0./s1 |
| InChIKey | SKPIHALEKKHSPX-JHEYCYPBSA-N |
| XLogP | 1.88 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|