C18H17F3N6 — CID 155942142
2-[4-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinoxaline (PubChem CID 155942142) has the molecular formula C18H17F3N6 and a molecular weight of 374.37 g/mol. Its IUPAC name is 2-[4-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinoxaline.
| Compound Name | 2-[4-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinoxaline |
|---|---|
| PubChem CID | 155942142 |
| Molecular Formula | C18H17F3N6 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[4-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinoxaline |
| SMILES | Cc1cc(C(F)(F)F)nc(N2CCN(c3cnc4ccccc4n3)CC2)n1 |
| InChI | InChI=1S/C18H17F3N6/c1-12-10-15(18(19,20)21)25-17(23-12)27-8-6-26(7-9-27)16-11-22-13-4-2-3-5-14(13)24-16/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | RFHYXZSZDSHPOS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |