C7H15ClN2O3 — CID 155943272
methyl 2-[3-aminopropanoyl(methyl)amino]acetate;hydrochloride (PubChem CID 155943272) has the molecular formula C7H15ClN2O3 and a molecular weight of 210.66 g/mol. Its IUPAC name is methyl 2-[3-aminopropanoyl(methyl)amino]acetate;hydrochloride.
| Compound Name | methyl 2-[3-aminopropanoyl(methyl)amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 155943272 |
| Molecular Formula | C7H15ClN2O3 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | methyl 2-[3-aminopropanoyl(methyl)amino]acetate;hydrochloride |
| SMILES | COC(=O)CN(C)C(=O)CCN.Cl |
| InChI | InChI=1S/C7H14N2O3.ClH/c1-9(5-7(11)12-2)6(10)3-4-8;/h3-5,8H2,1-2H3;1H |
| InChIKey | HVTLQOOCGSESDZ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |