C7H13NO3 — CID 43407357
methyl 2-[methyl(propanoyl)amino]acetate (PubChem CID 43407357) has the molecular formula C7H13NO3 and a molecular weight of 159.19 g/mol. Its IUPAC name is methyl 2-[methyl(propanoyl)amino]acetate.
| Compound Name | methyl 2-[methyl(propanoyl)amino]acetate |
|---|---|
| PubChem CID | 43407357 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | methyl 2-[methyl(propanoyl)amino]acetate |
| SMILES | CCC(=O)N(C)CC(=O)OC |
| InChI | InChI=1S/C7H13NO3/c1-4-6(9)8(2)5-7(10)11-3/h4-5H2,1-3H3 |
| InChIKey | WNLKQHCXSPSMEG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |