C26H24N2O3 — CID 155944574
4-[3-(hydroxymethyl)-3-phenylpiperidine-1-carbonyl]-10H-acridin-9-one (PubChem CID 155944574) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[3-(hydroxymethyl)-3-phenylpiperidine-1-carbonyl]-10H-acridin-9-one.
| Compound Name | 4-[3-(hydroxymethyl)-3-phenylpiperidine-1-carbonyl]-10H-acridin-9-one |
|---|---|
| PubChem CID | 155944574 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4-[3-(hydroxymethyl)-3-phenylpiperidine-1-carbonyl]-10H-acridin-9-one |
| SMILES | O=C(c1cccc2c(=O)c3ccccc3[nH]c12)N1CCCC(CO)(c2ccccc2)C1 |
| InChI | InChI=1S/C26H24N2O3/c29-17-26(18-8-2-1-3-9-18)14-7-15-28(16-26)25(31)21-12-6-11-20-23(21)27-22-13-5-4-10-19(22)24(20)30/h1-6,8-13,29H,7,14-17H2,(H,27,30) |
| InChIKey | TYXCDVPTNLLAHL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|