C20H23N3O3 — CID 155945861
1-(3-carbazol-9-yl-2-hydroxypropyl)-3-hydroxypyrrolidine-3-carboxamide (PubChem CID 155945861) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-(3-carbazol-9-yl-2-hydroxypropyl)-3-hydroxypyrrolidine-3-carboxamide.
| Compound Name | 1-(3-carbazol-9-yl-2-hydroxypropyl)-3-hydroxypyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155945861 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-(3-carbazol-9-yl-2-hydroxypropyl)-3-hydroxypyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1(O)CCN(CC(O)Cn2c3ccccc3c3ccccc32)C1 |
| InChI | InChI=1S/C20H23N3O3/c21-19(25)20(26)9-10-22(13-20)11-14(24)12-23-17-7-3-1-5-15(17)16-6-2-4-8-18(16)23/h1-8,14,24,26H,9-13H2,(H2,21,25) |
| InChIKey | CRCKREDWIQLJLA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |