C19H23F2N3O — CID 155946287
1-(4-cyano-2-fluorophenyl)-N-[(1-fluorocyclopentyl)methyl]piperidine-4-carboxamide (PubChem CID 155946287) has the molecular formula C19H23F2N3O and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-(4-cyano-2-fluorophenyl)-N-[(1-fluorocyclopentyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-cyano-2-fluorophenyl)-N-[(1-fluorocyclopentyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155946287 |
| Molecular Formula | C19H23F2N3O |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-(4-cyano-2-fluorophenyl)-N-[(1-fluorocyclopentyl)methyl]piperidine-4-carboxamide |
| SMILES | N#Cc1ccc(N2CCC(C(=O)NCC3(F)CCCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C19H23F2N3O/c20-16-11-14(12-22)3-4-17(16)24-9-5-15(6-10-24)18(25)23-13-19(21)7-1-2-8-19/h3-4,11,15H,1-2,5-10,13H2,(H,23,25) |
| InChIKey | MEYFDXLXGKMSAU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |