C18H23FN4O2 — CID 166286739
1-(4-cyano-2-fluorophenyl)-N-[2-(propanoylamino)ethyl]piperidine-4-carboxamide (PubChem CID 166286739) has the molecular formula C18H23FN4O2 and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-(4-cyano-2-fluorophenyl)-N-[2-(propanoylamino)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-cyano-2-fluorophenyl)-N-[2-(propanoylamino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 166286739 |
| Molecular Formula | C18H23FN4O2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-(4-cyano-2-fluorophenyl)-N-[2-(propanoylamino)ethyl]piperidine-4-carboxamide |
| SMILES | CCC(=O)NCCNC(=O)C1CCN(c2ccc(C#N)cc2F)CC1 |
| InChI | InChI=1S/C18H23FN4O2/c1-2-17(24)21-7-8-22-18(25)14-5-9-23(10-6-14)16-4-3-13(12-20)11-15(16)19/h3-4,11,14H,2,5-10H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | UIXHFFYPTVXZLL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|