C14H12ClN3O2S — CID 155948157
5-[(1S)-1-[(6-chloro-3-pyridinyl)oxy]ethyl]-3-(thiophen-2-ylmethyl)-1,2,4-oxadiazole (PubChem CID 155948157) has the molecular formula C14H12ClN3O2S and a molecular weight of 321.79 g/mol. Its IUPAC name is 5-[(1S)-1-[(6-chloro-3-pyridinyl)oxy]ethyl]-3-(thiophen-2-ylmethyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(1S)-1-[(6-chloro-3-pyridinyl)oxy]ethyl]-3-(thiophen-2-ylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 155948157 |
| Molecular Formula | C14H12ClN3O2S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 5-[(1S)-1-[(6-chloro-3-pyridinyl)oxy]ethyl]-3-(thiophen-2-ylmethyl)-1,2,4-oxadiazole |
| SMILES | C[C@H](Oc1ccc(Cl)nc1)c1nc(Cc2cccs2)no1 |
| InChI | InChI=1S/C14H12ClN3O2S/c1-9(19-10-4-5-12(15)16-8-10)14-17-13(18-20-14)7-11-3-2-6-21-11/h2-6,8-9H,7H2,1H3/t9-/m0/s1 |
| InChIKey | DYOPQOQEQGMHNM-VIFPVBQESA-N |
| XLogP | 3.91 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|