C14H14ClN5O2 — CID 155956495
5-[(1S)-1-[(6-chloro-3-pyridinyl)oxy]ethyl]-3-(1,5-dimethylpyrazol-3-yl)-1,2,4-oxadiazole (PubChem CID 155956495) has the molecular formula C14H14ClN5O2 and a molecular weight of 319.75 g/mol. Its IUPAC name is 5-[(1S)-1-[(6-chloro-3-pyridinyl)oxy]ethyl]-3-(1,5-dimethylpyrazol-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-[(1S)-1-[(6-chloro-3-pyridinyl)oxy]ethyl]-3-(1,5-dimethylpyrazol-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 155956495 |
| Molecular Formula | C14H14ClN5O2 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 5-[(1S)-1-[(6-chloro-3-pyridinyl)oxy]ethyl]-3-(1,5-dimethylpyrazol-3-yl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(-c2noc([C@H](C)Oc3ccc(Cl)nc3)n2)nn1C |
| InChI | InChI=1S/C14H14ClN5O2/c1-8-6-11(18-20(8)3)13-17-14(22-19-13)9(2)21-10-4-5-12(15)16-7-10/h4-7,9H,1-3H3/t9-/m0/s1 |
| InChIKey | NLYXTQFLNLEVMO-VIFPVBQESA-N |
| XLogP | 2.97 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|