C17H18N4O3 — CID 155950358
5-amino-6-(4-benzylidenepiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione (PubChem CID 155950358) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-amino-6-(4-benzylidenepiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-amino-6-(4-benzylidenepiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155950358 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 5-amino-6-(4-benzylidenepiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione |
| SMILES | Nc1c(C(=O)N2CCC(=Cc3ccccc3)CC2)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H18N4O3/c18-13-14(19-17(24)20-15(13)22)16(23)21-8-6-12(7-9-21)10-11-4-2-1-3-5-11/h1-5,10H,6-9,18H2,(H2,19,20,22,24) |
| InChIKey | TZZVUKBKUGRRQN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |